C12H10O3 — CID 70061931
4-(2,3-dihydro-1-benzofuran-5-yl)-2H-furan-5-one (PubChem CID 70061931) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-5-yl)-2H-furan-5-one.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-5-yl)-2H-furan-5-one |
|---|---|
| PubChem CID | 70061931 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-5-yl)-2H-furan-5-one |
| SMILES | O=C1OCC=C1c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H10O3/c13-12-10(4-6-15-12)8-1-2-11-9(7-8)3-5-14-11/h1-2,4,7H,3,5-6H2 |
| InChIKey | RATGFOLYQMTHCL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |