C16H11ClN2O — CID 28902016
1-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)phthalazine (PubChem CID 28902016) has the molecular formula C16H11ClN2O and a molecular weight of 282.73 g/mol. Its IUPAC name is 1-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)phthalazine.
| Compound Name | 1-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)phthalazine |
|---|---|
| PubChem CID | 28902016 |
| Molecular Formula | C16H11ClN2O |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)phthalazine |
| SMILES | Clc1nnc(-c2ccc3c(c2)CCO3)c2ccccc12 |
| InChI | InChI=1S/C16H11ClN2O/c17-16-13-4-2-1-3-12(13)15(18-19-16)11-5-6-14-10(9-11)7-8-20-14/h1-6,9H,7-8H2 |
| InChIKey | XIPCFYKNWSTLGX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |