About 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine
6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine (PubChem CID 104544727) has the molecular formula C13H9ClN4O
and a molecular weight of 272.69 g/mol. Its IUPAC name is 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 104544727 |
| Molecular Formula | C13H9ClN4O |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine |
| SMILES | Clc1nc(-c2ccc3c(c2)CCO3)c2cn[nH]c2n1 |
| InChI | InChI=1S/C13H9ClN4O/c14-13-16-11(9-6-15-18-12(9)17-13)8-1-2-10-7(5-8)3-4-19-10/h1-2,5-6H,3-4H2,(H,15,16,17,18) |
| InChIKey | ONYGLHDZASOHAO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine (CID 104544727) is 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine is Clc1nc(-c2ccc3c(c2)CCO3)c2cn[nH]c2n1.
What is the InChIKey of 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is ONYGLHDZASOHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClN4O/c14-13-16-11(9-6-15-18-12(9)17-13)8-1-2-10-7(5-8)3-4-19-10/h1-2,5-6H,3-4H2,(H,15,16,17,18).
What are the key properties of 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine?
6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine has a molecular weight of 272.69 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 104544727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).