C25H19FN2O2 — CID 139775453
4,5-bis(2,3-dihydro-1-benzofuran-5-yl)-2-(4-fluorophenyl)-1H-imidazole (PubChem CID 139775453) has the molecular formula C25H19FN2O2 and a molecular weight of 398.44 g/mol. Its IUPAC name is 4,5-bis(2,3-dihydro-1-benzofuran-5-yl)-2-(4-fluorophenyl)-1H-imidazole.
| Compound Name | 4,5-bis(2,3-dihydro-1-benzofuran-5-yl)-2-(4-fluorophenyl)-1H-imidazole |
|---|---|
| PubChem CID | 139775453 |
| Molecular Formula | C25H19FN2O2 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4,5-bis(2,3-dihydro-1-benzofuran-5-yl)-2-(4-fluorophenyl)-1H-imidazole |
| SMILES | Fc1ccc(-c2nc(-c3ccc4c(c3)CCO4)c(-c3ccc4c(c3)CCO4)[nH]2)cc1 |
| InChI | InChI=1S/C25H19FN2O2/c26-20-5-1-15(2-6-20)25-27-23(18-3-7-21-16(13-18)9-11-29-21)24(28-25)19-4-8-22-17(14-19)10-12-30-22/h1-8,13-14H,9-12H2,(H,27,28) |
| InChIKey | FPOIITZSVWWTCH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|