C13H10N4O3 — CID 115600454
8-(2,3-dihydro-1-benzofuran-5-yl)-3,7-dihydropurine-2,6-dione (PubChem CID 115600454) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 8-(2,3-dihydro-1-benzofuran-5-yl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(2,3-dihydro-1-benzofuran-5-yl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 115600454 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 8-(2,3-dihydro-1-benzofuran-5-yl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(-c3ccc4c(c3)CCO4)nc2[nH]1 |
| InChI | InChI=1S/C13H10N4O3/c18-12-9-11(16-13(19)17-12)15-10(14-9)7-1-2-8-6(5-7)3-4-20-8/h1-2,5H,3-4H2,(H3,14,15,16,17,18,19) |
| InChIKey | UCUHLFXGWBFZGL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |