C11H6BrFN4O2 — CID 115701685
8-(4-bromo-3-fluorophenyl)-3,7-dihydropurine-2,6-dione (PubChem CID 115701685) has the molecular formula C11H6BrFN4O2 and a molecular weight of 325.10 g/mol. Its IUPAC name is 8-(4-bromo-3-fluorophenyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(4-bromo-3-fluorophenyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 115701685 |
| Molecular Formula | C11H6BrFN4O2 |
| Molecular Weight | 325.10 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 8-(4-bromo-3-fluorophenyl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(-c3ccc(Br)c(F)c3)nc2[nH]1 |
| InChI | InChI=1S/C11H6BrFN4O2/c12-5-2-1-4(3-6(5)13)8-14-7-9(15-8)16-11(19)17-10(7)18/h1-3H,(H3,14,15,16,17,18,19) |
| InChIKey | XIITZLWNACIUDC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.10 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |