C13H12N4O4 — CID 115600427
8-(3,5-dimethoxyphenyl)-3,7-dihydropurine-2,6-dione (PubChem CID 115600427) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is 8-(3,5-dimethoxyphenyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(3,5-dimethoxyphenyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 115600427 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 8-(3,5-dimethoxyphenyl)-3,7-dihydropurine-2,6-dione |
| SMILES | COc1cc(OC)cc(-c2nc3[nH]c(=O)[nH]c(=O)c3[nH]2)c1 |
| InChI | InChI=1S/C13H12N4O4/c1-20-7-3-6(4-8(5-7)21-2)10-14-9-11(15-10)16-13(19)17-12(9)18/h3-5H,1-2H3,(H3,14,15,16,17,18,19) |
| InChIKey | ZBDRNCJVWFLHMG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |