C10H8N4O2S — CID 114402824
8-(4-methylthiophen-3-yl)-3,7-dihydropurine-2,6-dione (PubChem CID 114402824) has the molecular formula C10H8N4O2S and a molecular weight of 248.27 g/mol. Its IUPAC name is 8-(4-methylthiophen-3-yl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(4-methylthiophen-3-yl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402824 |
| Molecular Formula | C10H8N4O2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 8-(4-methylthiophen-3-yl)-3,7-dihydropurine-2,6-dione |
| SMILES | Cc1cscc1-c1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C10H8N4O2S/c1-4-2-17-3-5(4)7-11-6-8(12-7)13-10(16)14-9(6)15/h2-3H,1H3,(H3,11,12,13,14,15,16) |
| InChIKey | FFDOSIVATYDENF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |