C12H8F2N4O2 — CID 114402968
8-(2,6-difluoro-3-methylphenyl)-3,7-dihydropurine-2,6-dione (PubChem CID 114402968) has the molecular formula C12H8F2N4O2 and a molecular weight of 278.22 g/mol. Its IUPAC name is 8-(2,6-difluoro-3-methylphenyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(2,6-difluoro-3-methylphenyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402968 |
| Molecular Formula | C12H8F2N4O2 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 8-(2,6-difluoro-3-methylphenyl)-3,7-dihydropurine-2,6-dione |
| SMILES | Cc1ccc(F)c(-c2nc3[nH]c(=O)[nH]c(=O)c3[nH]2)c1F |
| InChI | InChI=1S/C12H8F2N4O2/c1-4-2-3-5(13)6(7(4)14)9-15-8-10(16-9)17-12(20)18-11(8)19/h2-3H,1H3,(H3,15,16,17,18,19,20) |
| InChIKey | LWWIDCSBLOOSTM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |