C13H13N5O3 — CID 114402276
8-[4-(2-hydroxyethylamino)phenyl]-3,7-dihydropurine-2,6-dione (PubChem CID 114402276) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 8-[4-(2-hydroxyethylamino)phenyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[4-(2-hydroxyethylamino)phenyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402276 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 8-[4-(2-hydroxyethylamino)phenyl]-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(-c3ccc(NCCO)cc3)nc2[nH]1 |
| InChI | InChI=1S/C13H13N5O3/c19-6-5-14-8-3-1-7(2-4-8)10-15-9-11(16-10)17-13(21)18-12(9)20/h1-4,14,19H,5-6H2,(H3,15,16,17,18,20,21) |
| InChIKey | CNNNQBYQIIUYTR-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |