C14H14N4O — CID 63268630
2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)anilino]ethanol (PubChem CID 63268630) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)anilino]ethanol.
| Compound Name | 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)anilino]ethanol |
|---|---|
| PubChem CID | 63268630 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)anilino]ethanol |
| SMILES | OCCNc1ccc(-c2nc3ccncc3[nH]2)cc1 |
| InChI | InChI=1S/C14H14N4O/c19-8-7-16-11-3-1-10(2-4-11)14-17-12-5-6-15-9-13(12)18-14/h1-6,9,16,19H,7-8H2,(H,17,18) |
| InChIKey | AUEVXRYHLZKQSE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |