C16H18ClN3O — CID 13450790
2-(4-butoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride (PubChem CID 13450790) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride.
| Compound Name | 2-(4-butoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 13450790 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-(4-butoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride |
| SMILES | CCCCOc1ccc(-c2nc3ccncc3[nH]2)cc1.Cl |
| InChI | InChI=1S/C16H17N3O.ClH/c1-2-3-10-20-13-6-4-12(5-7-13)16-18-14-8-9-17-11-15(14)19-16;/h4-9,11H,2-3,10H2,1H3,(H,18,19);1H |
| InChIKey | WAGYFFFHZNZAIZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|