C20H25N3O — CID 19938404
3-[4-(1H-benzimidazol-2-yl)phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 19938404) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-[4-(1H-benzimidazol-2-yl)phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-(1H-benzimidazol-2-yl)phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 19938404 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 3-[4-(1H-benzimidazol-2-yl)phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc(-c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C20H25N3O/c1-3-23(4-2)14-7-15-24-17-12-10-16(11-13-17)20-21-18-8-5-6-9-19(18)22-20/h5-6,8-13H,3-4,7,14-15H2,1-2H3,(H,21,22) |
| InChIKey | KVJPUBVSSMKTCE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|