C27H28F3N3O2 — CID 141074168
N,N-diethyl-3-[[2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-3H-benzimidazol-5-yl]oxy]propan-1-amine (PubChem CID 141074168) has the molecular formula C27H28F3N3O2 and a molecular weight of 483.53 g/mol. Its IUPAC name is N,N-diethyl-3-[[2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-3H-benzimidazol-5-yl]oxy]propan-1-amine.
| Compound Name | N,N-diethyl-3-[[2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-3H-benzimidazol-5-yl]oxy]propan-1-amine |
|---|---|
| PubChem CID | 141074168 |
| Molecular Formula | C27H28F3N3O2 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N,N-diethyl-3-[[2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-3H-benzimidazol-5-yl]oxy]propan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc2nc(-c3ccc(Oc4cccc(C(F)(F)F)c4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C27H28F3N3O2/c1-3-33(4-2)15-6-16-34-22-13-14-24-25(18-22)32-26(31-24)19-9-11-21(12-10-19)35-23-8-5-7-20(17-23)27(28,29)30/h5,7-14,17-18H,3-4,6,15-16H2,1-2H3,(H,31,32) |
| InChIKey | CUMBOOAFDYVBLD-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|