C23H30F3NO — CID 173414314
N,N-diethyl-3-[4-[1-[3-(trifluoromethyl)phenyl]propyl]phenoxy]propan-1-amine (PubChem CID 173414314) has the molecular formula C23H30F3NO and a molecular weight of 393.49 g/mol. Its IUPAC name is N,N-diethyl-3-[4-[1-[3-(trifluoromethyl)phenyl]propyl]phenoxy]propan-1-amine.
| Compound Name | N,N-diethyl-3-[4-[1-[3-(trifluoromethyl)phenyl]propyl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 173414314 |
| Molecular Formula | C23H30F3NO |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N,N-diethyl-3-[4-[1-[3-(trifluoromethyl)phenyl]propyl]phenoxy]propan-1-amine |
| SMILES | CCC(c1ccc(OCCCN(CC)CC)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H30F3NO/c1-4-22(19-9-7-10-20(17-19)23(24,25)26)18-11-13-21(14-12-18)28-16-8-15-27(5-2)6-3/h7,9-14,17,22H,4-6,8,15-16H2,1-3H3 |
| InChIKey | SORVSQSDTLFYNR-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|