C37H52N4O3 — CID 59699325
3-[[2-[3-(4-tert-butylphenoxy)phenyl]-7-[3-(diethylamino)propoxy]-3H-benzimidazol-5-yl]oxy]-N,N-diethylpropan-1-amine (PubChem CID 59699325) has the molecular formula C37H52N4O3 and a molecular weight of 600.85 g/mol. Its IUPAC name is 3-[[2-[3-(4-tert-butylphenoxy)phenyl]-7-[3-(diethylamino)propoxy]-3H-benzimidazol-5-yl]oxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[[2-[3-(4-tert-butylphenoxy)phenyl]-7-[3-(diethylamino)propoxy]-3H-benzimidazol-5-yl]oxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 59699325 |
| Molecular Formula | C37H52N4O3 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.40 |
| IUPAC Name | 3-[[2-[3-(4-tert-butylphenoxy)phenyl]-7-[3-(diethylamino)propoxy]-3H-benzimidazol-5-yl]oxy]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1cc(OCCCN(CC)CC)c2nc(-c3cccc(Oc4ccc(C(C)(C)C)cc4)c3)[nH]c2c1 |
| InChI | InChI=1S/C37H52N4O3/c1-8-40(9-2)21-13-23-42-32-26-33-35(34(27-32)43-24-14-22-41(10-3)11-4)39-36(38-33)28-15-12-16-31(25-28)44-30-19-17-29(18-20-30)37(5,6)7/h12,15-20,25-27H,8-11,13-14,21-24H2,1-7H3,(H,38,39) |
| InChIKey | NNLFLWTZOZDZJK-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 62.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|