C43H60N4O3 — CID 59698902
4,6-bis[2-(azepan-1-yl)ethoxy]-1-butyl-2-[3-(4-tert-butylphenoxy)phenyl]benzimidazole (PubChem CID 59698902) has the molecular formula C43H60N4O3 and a molecular weight of 680.98 g/mol. Its IUPAC name is 4,6-bis[2-(azepan-1-yl)ethoxy]-1-butyl-2-[3-(4-tert-butylphenoxy)phenyl]benzimidazole.
| Compound Name | 4,6-bis[2-(azepan-1-yl)ethoxy]-1-butyl-2-[3-(4-tert-butylphenoxy)phenyl]benzimidazole |
|---|---|
| PubChem CID | 59698902 |
| Molecular Formula | C43H60N4O3 |
| Molecular Weight | 680.98 g/mol |
| Exact Mass | 680.47 |
| IUPAC Name | 4,6-bis[2-(azepan-1-yl)ethoxy]-1-butyl-2-[3-(4-tert-butylphenoxy)phenyl]benzimidazole |
| SMILES | CCCCn1c(-c2cccc(Oc3ccc(C(C)(C)C)cc3)c2)nc2c(OCCN3CCCCCC3)cc(OCCN3CCCCCC3)cc21 |
| InChI | InChI=1S/C43H60N4O3/c1-5-6-26-47-39-32-38(48-29-27-45-22-11-7-8-12-23-45)33-40(49-30-28-46-24-13-9-10-14-25-46)41(39)44-42(47)34-16-15-17-37(31-34)50-36-20-18-35(19-21-36)43(2,3)4/h15-21,31-33H,5-14,22-30H2,1-4H3 |
| InChIKey | ZXEBZJSAQBSEBO-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 51.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.98 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |