C36H37N5O2 — CID 66977278
4-[4-[3-[1-butyl-6-(2-piperazin-1-ylethoxy)benzimidazol-2-yl]phenoxy]phenyl]benzonitrile (PubChem CID 66977278) has the molecular formula C36H37N5O2 and a molecular weight of 571.73 g/mol. Its IUPAC name is 4-[4-[3-[1-butyl-6-(2-piperazin-1-ylethoxy)benzimidazol-2-yl]phenoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[3-[1-butyl-6-(2-piperazin-1-ylethoxy)benzimidazol-2-yl]phenoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 66977278 |
| Molecular Formula | C36H37N5O2 |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | 4-[4-[3-[1-butyl-6-(2-piperazin-1-ylethoxy)benzimidazol-2-yl]phenoxy]phenyl]benzonitrile |
| SMILES | CCCCn1c(-c2cccc(Oc3ccc(-c4ccc(C#N)cc4)cc3)c2)nc2ccc(OCCN3CCNCC3)cc21 |
| InChI | InChI=1S/C36H37N5O2/c1-2-3-19-41-35-25-32(42-23-22-40-20-17-38-18-21-40)15-16-34(35)39-36(41)30-5-4-6-33(24-30)43-31-13-11-29(12-14-31)28-9-7-27(26-37)8-10-28/h4-16,24-25,38H,2-3,17-23H2,1H3 |
| InChIKey | XDVLUUNKPDREPQ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |