C33H41N3O3 — CID 59699191
4-[2-[3-butyl-2-[3-(4-tert-butylphenoxy)phenyl]benzimidazol-5-yl]oxyethyl]morpholine (PubChem CID 59699191) has the molecular formula C33H41N3O3 and a molecular weight of 527.71 g/mol. Its IUPAC name is 4-[2-[3-butyl-2-[3-(4-tert-butylphenoxy)phenyl]benzimidazol-5-yl]oxyethyl]morpholine.
| Compound Name | 4-[2-[3-butyl-2-[3-(4-tert-butylphenoxy)phenyl]benzimidazol-5-yl]oxyethyl]morpholine |
|---|---|
| PubChem CID | 59699191 |
| Molecular Formula | C33H41N3O3 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | 4-[2-[3-butyl-2-[3-(4-tert-butylphenoxy)phenyl]benzimidazol-5-yl]oxyethyl]morpholine |
| SMILES | CCCCn1c(-c2cccc(Oc3ccc(C(C)(C)C)cc3)c2)nc2ccc(OCCN3CCOCC3)cc21 |
| InChI | InChI=1S/C33H41N3O3/c1-5-6-16-36-31-24-28(38-22-19-35-17-20-37-21-18-35)14-15-30(31)34-32(36)25-8-7-9-29(23-25)39-27-12-10-26(11-13-27)33(2,3)4/h7-15,23-24H,5-6,16-22H2,1-4H3 |
| InChIKey | TZEBNNUYWQXILF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |