C37H51ClN4O3 — CID 59699089
3-[3-butyl-2-[4-(3-chlorophenoxy)phenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine (PubChem CID 59699089) has the molecular formula C37H51ClN4O3 and a molecular weight of 635.29 g/mol. Its IUPAC name is 3-[3-butyl-2-[4-(3-chlorophenoxy)phenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine.
| Compound Name | 3-[3-butyl-2-[4-(3-chlorophenoxy)phenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 59699089 |
| Molecular Formula | C37H51ClN4O3 |
| Molecular Weight | 635.29 g/mol |
| Exact Mass | 634.36 |
| IUPAC Name | 3-[3-butyl-2-[4-(3-chlorophenoxy)phenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine |
| SMILES | CCCCn1c(-c2ccc(Oc3cccc(Cl)c3)cc2)nc2c(OCCCN(CC)CC)cc(OCCCN(CC)CC)cc21 |
| InChI | InChI=1S/C37H51ClN4O3/c1-6-11-23-42-34-27-33(43-24-13-21-40(7-2)8-3)28-35(44-25-14-22-41(9-4)10-5)36(34)39-37(42)29-17-19-31(20-18-29)45-32-16-12-15-30(38)26-32/h12,15-20,26-28H,6-11,13-14,21-25H2,1-5H3 |
| InChIKey | RRLXFDLHVUBTTQ-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 51.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.29 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|