C31H39N3O2 — CID 59699031
3-[3-butyl-2-(4-phenylmethoxyphenyl)benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine (PubChem CID 59699031) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is 3-[3-butyl-2-(4-phenylmethoxyphenyl)benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine.
| Compound Name | 3-[3-butyl-2-(4-phenylmethoxyphenyl)benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 59699031 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 3-[3-butyl-2-(4-phenylmethoxyphenyl)benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine |
| SMILES | CCCCn1c(-c2ccc(OCc3ccccc3)cc2)nc2ccc(OCCCN(CC)CC)cc21 |
| InChI | InChI=1S/C31H39N3O2/c1-4-7-21-34-30-23-28(35-22-11-20-33(5-2)6-3)18-19-29(30)32-31(34)26-14-16-27(17-15-26)36-24-25-12-9-8-10-13-25/h8-10,12-19,23H,4-7,11,20-22,24H2,1-3H3 |
| InChIKey | FCTOSYANTKVSPU-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|