C38H41N5O2 — CID 19938405
N,N-diethyl-3-[4-[1-[(E)-4-[2-(4-methoxyphenyl)benzimidazol-1-yl]but-2-enyl]benzimidazol-2-yl]phenoxy]propan-1-amine (PubChem CID 19938405) has the molecular formula C38H41N5O2 and a molecular weight of 599.78 g/mol. Its IUPAC name is N,N-diethyl-3-[4-[1-[(E)-4-[2-(4-methoxyphenyl)benzimidazol-1-yl]but-2-enyl]benzimidazol-2-yl]phenoxy]propan-1-amine.
| Compound Name | N,N-diethyl-3-[4-[1-[(E)-4-[2-(4-methoxyphenyl)benzimidazol-1-yl]but-2-enyl]benzimidazol-2-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 19938405 |
| Molecular Formula | C38H41N5O2 |
| Molecular Weight | 599.78 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | N,N-diethyl-3-[4-[1-[(E)-4-[2-(4-methoxyphenyl)benzimidazol-1-yl]but-2-enyl]benzimidazol-2-yl]phenoxy]propan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc(-c2nc3ccccc3n2C/C=C/Cn2c(-c3ccc(OC)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C38H41N5O2/c1-4-41(5-2)25-12-28-45-32-23-19-30(20-24-32)38-40-34-14-7-9-16-36(34)43(38)27-11-10-26-42-35-15-8-6-13-33(35)39-37(42)29-17-21-31(44-3)22-18-29/h6-11,13-24H,4-5,12,25-28H2,1-3H3/b11-10+ |
| InChIKey | DNKCJBSJSPBJID-ZHACJKMWSA-N |
| XLogP | 8.10 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.78 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|