C37H39N5O — CID 15291585
N,N-diethyl-3-[4-[1-[(E)-4-(2-phenylbenzimidazol-1-yl)but-2-enyl]benzimidazol-2-yl]phenoxy]propan-1-amine (PubChem CID 15291585) has the molecular formula C37H39N5O and a molecular weight of 569.75 g/mol. Its IUPAC name is N,N-diethyl-3-[4-[1-[(E)-4-(2-phenylbenzimidazol-1-yl)but-2-enyl]benzimidazol-2-yl]phenoxy]propan-1-amine.
| Compound Name | N,N-diethyl-3-[4-[1-[(E)-4-(2-phenylbenzimidazol-1-yl)but-2-enyl]benzimidazol-2-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 15291585 |
| Molecular Formula | C37H39N5O |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.32 |
| IUPAC Name | N,N-diethyl-3-[4-[1-[(E)-4-(2-phenylbenzimidazol-1-yl)but-2-enyl]benzimidazol-2-yl]phenoxy]propan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc(-c2nc3ccccc3n2C/C=C/Cn2c(-c3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C37H39N5O/c1-3-40(4-2)25-14-28-43-31-23-21-30(22-24-31)37-39-33-18-9-11-20-35(33)42(37)27-13-12-26-41-34-19-10-8-17-32(34)38-36(41)29-15-6-5-7-16-29/h5-13,15-24H,3-4,14,25-28H2,1-2H3/b13-12+ |
| InChIKey | OIVYFRNOFHRRJS-OUKQBFOZSA-N |
| XLogP | 8.09 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|