C20H25N3O — CID 21391
N,N-diethyl-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]ethanamine (PubChem CID 21391) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N,N-diethyl-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]ethanamine.
| Compound Name | N,N-diethyl-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 21391 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N,N-diethyl-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]ethanamine |
| SMILES | CCN(CC)CCn1c(-c2ccc(OC)cc2)nc2ccccc21 |
| InChI | InChI=1S/C20H25N3O/c1-4-22(5-2)14-15-23-19-9-7-6-8-18(19)21-20(23)16-10-12-17(24-3)13-11-16/h6-13H,4-5,14-15H2,1-3H3 |
| InChIKey | YLTOMFFHIPAEJR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |