C52H70N6O2 — CID 19938408
N-butyl-N-[3-[4-[1-[(E)-4-[2-[4-[3-(dibutylamino)propoxy]phenyl]benzimidazol-1-yl]but-2-enyl]benzimidazol-2-yl]phenoxy]propyl]butan-1-amine (PubChem CID 19938408) has the molecular formula C52H70N6O2 and a molecular weight of 811.17 g/mol. Its IUPAC name is N-butyl-N-[3-[4-[1-[(E)-4-[2-[4-[3-(dibutylamino)propoxy]phenyl]benzimidazol-1-yl]but-2-enyl]benzimidazol-2-yl]phenoxy]propyl]butan-1-amine.
| Compound Name | N-butyl-N-[3-[4-[1-[(E)-4-[2-[4-[3-(dibutylamino)propoxy]phenyl]benzimidazol-1-yl]but-2-enyl]benzimidazol-2-yl]phenoxy]propyl]butan-1-amine |
|---|---|
| PubChem CID | 19938408 |
| Molecular Formula | C52H70N6O2 |
| Molecular Weight | 811.17 g/mol |
| Exact Mass | 810.56 |
| IUPAC Name | N-butyl-N-[3-[4-[1-[(E)-4-[2-[4-[3-(dibutylamino)propoxy]phenyl]benzimidazol-1-yl]but-2-enyl]benzimidazol-2-yl]phenoxy]propyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCCOc1ccc(-c2nc3ccccc3n2C/C=C/Cn2c(-c3ccc(OCCCN(CCCC)CCCC)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C52H70N6O2/c1-5-9-33-55(34-10-6-2)37-19-41-59-45-29-25-43(26-30-45)51-53-47-21-13-15-23-49(47)57(51)39-17-18-40-58-50-24-16-14-22-48(50)54-52(58)44-27-31-46(32-28-44)60-42-20-38-56(35-11-7-3)36-12-8-4/h13-18,21-32H,5-12,19-20,33-42H2,1-4H3/b18-17+ |
| InChIKey | JIKDWCBMJVTCCZ-ISLYRVAYSA-N |
| XLogP | 12.32 |
| TPSA | 60.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.17 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|