C28H32N2O — CID 17000955
1-[4-(4-butan-2-ylphenoxy)butyl]-2-(4-methylphenyl)benzimidazole (PubChem CID 17000955) has the molecular formula C28H32N2O and a molecular weight of 412.58 g/mol. Its IUPAC name is 1-[4-(4-butan-2-ylphenoxy)butyl]-2-(4-methylphenyl)benzimidazole.
| Compound Name | 1-[4-(4-butan-2-ylphenoxy)butyl]-2-(4-methylphenyl)benzimidazole |
|---|---|
| PubChem CID | 17000955 |
| Molecular Formula | C28H32N2O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 1-[4-(4-butan-2-ylphenoxy)butyl]-2-(4-methylphenyl)benzimidazole |
| SMILES | CCC(C)c1ccc(OCCCCn2c(-c3ccc(C)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C28H32N2O/c1-4-22(3)23-15-17-25(18-16-23)31-20-8-7-19-30-27-10-6-5-9-26(27)29-28(30)24-13-11-21(2)12-14-24/h5-6,9-18,22H,4,7-8,19-20H2,1-3H3 |
| InChIKey | RELHNICDJATUFR-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|