C23H30N2O2 — CID 16996938
1-[4-(4-butan-2-ylphenoxy)butyl]-2-(methoxymethyl)benzimidazole (PubChem CID 16996938) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[4-(4-butan-2-ylphenoxy)butyl]-2-(methoxymethyl)benzimidazole.
| Compound Name | 1-[4-(4-butan-2-ylphenoxy)butyl]-2-(methoxymethyl)benzimidazole |
|---|---|
| PubChem CID | 16996938 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-[4-(4-butan-2-ylphenoxy)butyl]-2-(methoxymethyl)benzimidazole |
| SMILES | CCC(C)c1ccc(OCCCCn2c(COC)nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H30N2O2/c1-4-18(2)19-11-13-20(14-12-19)27-16-8-7-15-25-22-10-6-5-9-21(22)24-23(25)17-26-3/h5-6,9-14,18H,4,7-8,15-17H2,1-3H3 |
| InChIKey | HRHKWIVESOCEQP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|