C27H30N2O2 — CID 16998217
1-[2-(4-butan-2-ylphenoxy)ethyl]-2-[(4-methylphenoxy)methyl]benzimidazole (PubChem CID 16998217) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-[2-(4-butan-2-ylphenoxy)ethyl]-2-[(4-methylphenoxy)methyl]benzimidazole.
| Compound Name | 1-[2-(4-butan-2-ylphenoxy)ethyl]-2-[(4-methylphenoxy)methyl]benzimidazole |
|---|---|
| PubChem CID | 16998217 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-[2-(4-butan-2-ylphenoxy)ethyl]-2-[(4-methylphenoxy)methyl]benzimidazole |
| SMILES | CCC(C)c1ccc(OCCn2c(COc3ccc(C)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C27H30N2O2/c1-4-21(3)22-11-15-23(16-12-22)30-18-17-29-26-8-6-5-7-25(26)28-27(29)19-31-24-13-9-20(2)10-14-24/h5-16,21H,4,17-19H2,1-3H3 |
| InChIKey | PKLKYKBHPGWJTA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |