C29H34N2O2 — CID 16998750
2-[(4-tert-butylphenoxy)methyl]-1-[2-(4-propan-2-ylphenoxy)ethyl]benzimidazole (PubChem CID 16998750) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is 2-[(4-tert-butylphenoxy)methyl]-1-[2-(4-propan-2-ylphenoxy)ethyl]benzimidazole.
| Compound Name | 2-[(4-tert-butylphenoxy)methyl]-1-[2-(4-propan-2-ylphenoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 16998750 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-[(4-tert-butylphenoxy)methyl]-1-[2-(4-propan-2-ylphenoxy)ethyl]benzimidazole |
| SMILES | CC(C)c1ccc(OCCn2c(COc3ccc(C(C)(C)C)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C29H34N2O2/c1-21(2)22-10-14-24(15-11-22)32-19-18-31-27-9-7-6-8-26(27)30-28(31)20-33-25-16-12-23(13-17-25)29(3,4)5/h6-17,21H,18-20H2,1-5H3 |
| InChIKey | ZHPAAPCGEODPSM-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |