C32H32N2O — CID 16987415
1-[2-(4-tert-butylphenoxy)ethyl]-2-[(4-phenylphenyl)methyl]benzimidazole (PubChem CID 16987415) has the molecular formula C32H32N2O and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenoxy)ethyl]-2-[(4-phenylphenyl)methyl]benzimidazole.
| Compound Name | 1-[2-(4-tert-butylphenoxy)ethyl]-2-[(4-phenylphenyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 16987415 |
| Molecular Formula | C32H32N2O |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 1-[2-(4-tert-butylphenoxy)ethyl]-2-[(4-phenylphenyl)methyl]benzimidazole |
| SMILES | CC(C)(C)c1ccc(OCCn2c(Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C32H32N2O/c1-32(2,3)27-17-19-28(20-18-27)35-22-21-34-30-12-8-7-11-29(30)33-31(34)23-24-13-15-26(16-14-24)25-9-5-4-6-10-25/h4-20H,21-23H2,1-3H3 |
| InChIKey | SDDJSCYCBIOJNM-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |