C34H35N3O2 — CID 16971461
N-[[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]methyl]-2-(4-phenylphenyl)acetamide (PubChem CID 16971461) has the molecular formula C34H35N3O2 and a molecular weight of 517.67 g/mol. Its IUPAC name is N-[[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]methyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]methyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16971461 |
| Molecular Formula | C34H35N3O2 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | N-[[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]methyl]-2-(4-phenylphenyl)acetamide |
| SMILES | CC(C)(C)c1ccc(OCCn2c(CNC(=O)Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C34H35N3O2/c1-34(2,3)28-17-19-29(20-18-28)39-22-21-37-31-12-8-7-11-30(31)36-32(37)24-35-33(38)23-25-13-15-27(16-14-25)26-9-5-4-6-10-26/h4-20H,21-24H2,1-3H3,(H,35,38) |
| InChIKey | IYYYJCGTNXAUCV-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |