C24H26N2OS — CID 19242958
1-[2-(4-tert-butylphenoxy)ethyl]-2-(thiophen-2-ylmethyl)benzimidazole (PubChem CID 19242958) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenoxy)ethyl]-2-(thiophen-2-ylmethyl)benzimidazole.
| Compound Name | 1-[2-(4-tert-butylphenoxy)ethyl]-2-(thiophen-2-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 19242958 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-[2-(4-tert-butylphenoxy)ethyl]-2-(thiophen-2-ylmethyl)benzimidazole |
| SMILES | CC(C)(C)c1ccc(OCCn2c(Cc3cccs3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H26N2OS/c1-24(2,3)18-10-12-19(13-11-18)27-15-14-26-22-9-5-4-8-21(22)25-23(26)17-20-7-6-16-28-20/h4-13,16H,14-15,17H2,1-3H3 |
| InChIKey | FNNHJSSPYOTHPJ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |