C32H39N3O2 — CID 16973277
N-[1-[1-[4-(4-butan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(2-methylphenyl)acetamide (PubChem CID 16973277) has the molecular formula C32H39N3O2 and a molecular weight of 497.68 g/mol. Its IUPAC name is N-[1-[1-[4-(4-butan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(2-methylphenyl)acetamide.
| Compound Name | N-[1-[1-[4-(4-butan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16973277 |
| Molecular Formula | C32H39N3O2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | N-[1-[1-[4-(4-butan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(2-methylphenyl)acetamide |
| SMILES | CCC(C)c1ccc(OCCCCn2c(C(C)NC(=O)Cc3ccccc3C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C32H39N3O2/c1-5-23(2)26-16-18-28(19-17-26)37-21-11-10-20-35-30-15-9-8-14-29(30)34-32(35)25(4)33-31(36)22-27-13-7-6-12-24(27)3/h6-9,12-19,23,25H,5,10-11,20-22H2,1-4H3,(H,33,36) |
| InChIKey | UTPDQIMDCDYSGQ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|