C27H28Cl2N2O — CID 16987795
1-[4-(4-butan-2-ylphenoxy)butyl]-2-(2,4-dichlorophenyl)benzimidazole (PubChem CID 16987795) has the molecular formula C27H28Cl2N2O and a molecular weight of 467.44 g/mol. Its IUPAC name is 1-[4-(4-butan-2-ylphenoxy)butyl]-2-(2,4-dichlorophenyl)benzimidazole.
| Compound Name | 1-[4-(4-butan-2-ylphenoxy)butyl]-2-(2,4-dichlorophenyl)benzimidazole |
|---|---|
| PubChem CID | 16987795 |
| Molecular Formula | C27H28Cl2N2O |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-[4-(4-butan-2-ylphenoxy)butyl]-2-(2,4-dichlorophenyl)benzimidazole |
| SMILES | CCC(C)c1ccc(OCCCCn2c(-c3ccc(Cl)cc3Cl)nc3ccccc32)cc1 |
| InChI | InChI=1S/C27H28Cl2N2O/c1-3-19(2)20-10-13-22(14-11-20)32-17-7-6-16-31-26-9-5-4-8-25(26)30-27(31)23-15-12-21(28)18-24(23)29/h4-5,8-15,18-19H,3,6-7,16-17H2,1-2H3 |
| InChIKey | FHOASEGDQIPOEY-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|