C24H22Cl2N2O — CID 16987724
2-(2,4-dichlorophenyl)-1-[2-(2-propan-2-ylphenoxy)ethyl]benzimidazole (PubChem CID 16987724) has the molecular formula C24H22Cl2N2O and a molecular weight of 425.36 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-[2-(2-propan-2-ylphenoxy)ethyl]benzimidazole.
| Compound Name | 2-(2,4-dichlorophenyl)-1-[2-(2-propan-2-ylphenoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 16987724 |
| Molecular Formula | C24H22Cl2N2O |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-[2-(2-propan-2-ylphenoxy)ethyl]benzimidazole |
| SMILES | CC(C)c1ccccc1OCCn1c(-c2ccc(Cl)cc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C24H22Cl2N2O/c1-16(2)18-7-3-6-10-23(18)29-14-13-28-22-9-5-4-8-21(22)27-24(28)19-12-11-17(25)15-20(19)26/h3-12,15-16H,13-14H2,1-2H3 |
| InChIKey | OLEMTAXCMXHUKB-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |