C25H24Cl2N2O — CID 16987792
2-(2,4-dichlorophenyl)-1-[4-(4-ethylphenoxy)butyl]benzimidazole (PubChem CID 16987792) has the molecular formula C25H24Cl2N2O and a molecular weight of 439.39 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-[4-(4-ethylphenoxy)butyl]benzimidazole.
| Compound Name | 2-(2,4-dichlorophenyl)-1-[4-(4-ethylphenoxy)butyl]benzimidazole |
|---|---|
| PubChem CID | 16987792 |
| Molecular Formula | C25H24Cl2N2O |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-[4-(4-ethylphenoxy)butyl]benzimidazole |
| SMILES | CCc1ccc(OCCCCn2c(-c3ccc(Cl)cc3Cl)nc3ccccc32)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O/c1-2-18-9-12-20(13-10-18)30-16-6-5-15-29-24-8-4-3-7-23(24)28-25(29)21-14-11-19(26)17-22(21)27/h3-4,7-14,17H,2,5-6,15-16H2,1H3 |
| InChIKey | KXYSSPYGNAWPBF-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|