C34H45N3O2 — CID 58967341
N-[(6-butoxy-1-butylbenzimidazol-2-yl)methyl]-2-methyl-N-[(4-phenylmethoxyphenyl)methyl]propan-1-amine (PubChem CID 58967341) has the molecular formula C34H45N3O2 and a molecular weight of 527.75 g/mol. Its IUPAC name is N-[(6-butoxy-1-butylbenzimidazol-2-yl)methyl]-2-methyl-N-[(4-phenylmethoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(6-butoxy-1-butylbenzimidazol-2-yl)methyl]-2-methyl-N-[(4-phenylmethoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 58967341 |
| Molecular Formula | C34H45N3O2 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.35 |
| IUPAC Name | N-[(6-butoxy-1-butylbenzimidazol-2-yl)methyl]-2-methyl-N-[(4-phenylmethoxyphenyl)methyl]propan-1-amine |
| SMILES | CCCCOc1ccc2nc(CN(Cc3ccc(OCc4ccccc4)cc3)CC(C)C)n(CCCC)c2c1 |
| InChI | InChI=1S/C34H45N3O2/c1-5-7-20-37-33-22-31(38-21-8-6-2)18-19-32(33)35-34(37)25-36(23-27(3)4)24-28-14-16-30(17-15-28)39-26-29-12-10-9-11-13-29/h9-19,22,27H,5-8,20-21,23-26H2,1-4H3 |
| InChIKey | UIIQTYGOKOCRJO-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|