C38H52N4O4 — CID 10282752
tert-butyl N-[1-[1-butyl-6-[3-(diethylamino)propoxy]benzimidazol-2-yl]-2-(3-phenylmethoxyphenyl)ethyl]carbamate (PubChem CID 10282752) has the molecular formula C38H52N4O4 and a molecular weight of 628.86 g/mol. Its IUPAC name is tert-butyl N-[1-[1-butyl-6-[3-(diethylamino)propoxy]benzimidazol-2-yl]-2-(3-phenylmethoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[1-butyl-6-[3-(diethylamino)propoxy]benzimidazol-2-yl]-2-(3-phenylmethoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 10282752 |
| Molecular Formula | C38H52N4O4 |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.40 |
| IUPAC Name | tert-butyl N-[1-[1-butyl-6-[3-(diethylamino)propoxy]benzimidazol-2-yl]-2-(3-phenylmethoxyphenyl)ethyl]carbamate |
| SMILES | CCCCn1c(C(Cc2cccc(OCc3ccccc3)c2)NC(=O)OC(C)(C)C)nc2ccc(OCCCN(CC)CC)cc21 |
| InChI | InChI=1S/C38H52N4O4/c1-7-10-23-42-35-27-32(44-24-15-22-41(8-2)9-3)20-21-33(35)39-36(42)34(40-37(43)46-38(4,5)6)26-30-18-14-19-31(25-30)45-28-29-16-12-11-13-17-29/h11-14,16-21,25,27,34H,7-10,15,22-24,26,28H2,1-6H3,(H,40,43) |
| InChIKey | WESWZIVXCOPGRB-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|