C41H62N4O3 — CID 142805826
N-[4-[1-butyl-6-[3-(diethylamino)propoxy]benzimidazol-2-yl]-2-(2-phenylethoxy)phenyl]-2,2-dimethylpropanamide;ethane (PubChem CID 142805826) has the molecular formula C41H62N4O3 and a molecular weight of 658.97 g/mol. Its IUPAC name is N-[4-[1-butyl-6-[3-(diethylamino)propoxy]benzimidazol-2-yl]-2-(2-phenylethoxy)phenyl]-2,2-dimethylpropanamide;ethane.
| Compound Name | N-[4-[1-butyl-6-[3-(diethylamino)propoxy]benzimidazol-2-yl]-2-(2-phenylethoxy)phenyl]-2,2-dimethylpropanamide;ethane |
|---|---|
| PubChem CID | 142805826 |
| Molecular Formula | C41H62N4O3 |
| Molecular Weight | 658.97 g/mol |
| Exact Mass | 658.48 |
| IUPAC Name | N-[4-[1-butyl-6-[3-(diethylamino)propoxy]benzimidazol-2-yl]-2-(2-phenylethoxy)phenyl]-2,2-dimethylpropanamide;ethane |
| SMILES | CC.CC.CCCCn1c(-c2ccc(NC(=O)C(C)(C)C)c(OCCc3ccccc3)c2)nc2ccc(OCCCN(CC)CC)cc21 |
| InChI | InChI=1S/C37H50N4O3.2C2H6/c1-7-10-23-41-33-27-30(43-24-14-22-40(8-2)9-3)18-20-31(33)38-35(41)29-17-19-32(39-36(42)37(4,5)6)34(26-29)44-25-21-28-15-12-11-13-16-28;2*1-2/h11-13,15-20,26-27H,7-10,14,21-25H2,1-6H3,(H,39,42);2*1-2H3 |
| InChIKey | RZXZFKLGCWKHDV-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.97 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|