C37H47ClN4O4 — CID 90670656
N-[2-butoxy-4-[3-(diethylamino)propoxy]phenyl]-1-butyl-5-[4-(4-chlorophenoxy)phenyl]pyrazole-3-carboxamide (PubChem CID 90670656) has the molecular formula C37H47ClN4O4 and a molecular weight of 647.26 g/mol. Its IUPAC name is N-[2-butoxy-4-[3-(diethylamino)propoxy]phenyl]-1-butyl-5-[4-(4-chlorophenoxy)phenyl]pyrazole-3-carboxamide.
| Compound Name | N-[2-butoxy-4-[3-(diethylamino)propoxy]phenyl]-1-butyl-5-[4-(4-chlorophenoxy)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 90670656 |
| Molecular Formula | C37H47ClN4O4 |
| Molecular Weight | 647.26 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | N-[2-butoxy-4-[3-(diethylamino)propoxy]phenyl]-1-butyl-5-[4-(4-chlorophenoxy)phenyl]pyrazole-3-carboxamide |
| SMILES | CCCCOc1cc(OCCCN(CC)CC)ccc1NC(=O)c1cc(-c2ccc(Oc3ccc(Cl)cc3)cc2)n(CCCC)n1 |
| InChI | InChI=1S/C37H47ClN4O4/c1-5-9-23-42-35(28-12-16-30(17-13-28)46-31-18-14-29(38)15-19-31)27-34(40-42)37(43)39-33-21-20-32(26-36(33)45-24-10-6-2)44-25-11-22-41(7-3)8-4/h12-21,26-27H,5-11,22-25H2,1-4H3,(H,39,43) |
| InChIKey | BVFXUNCGHDWVPP-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.26 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|