C33H40ClN3O2 — CID 25144844
3-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]-5-methylimidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 25144844) has the molecular formula C33H40ClN3O2 and a molecular weight of 546.16 g/mol. Its IUPAC name is 3-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]-5-methylimidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]-5-methylimidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 25144844 |
| Molecular Formula | C33H40ClN3O2 |
| Molecular Weight | 546.16 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 3-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]-5-methylimidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCCCc1nc(-c2ccc(OCCCN(CC)CC)cc2)c(C)n1-c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C33H40ClN3O2/c1-5-8-10-32-35-33(26-11-17-29(18-12-26)38-24-9-23-36(6-2)7-3)25(4)37(32)28-15-21-31(22-16-28)39-30-19-13-27(34)14-20-30/h11-22H,5-10,23-24H2,1-4H3 |
| InChIKey | GOKMRUDQKCCPKA-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.16 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|