C32H37Cl2N3O2 — CID 59699013
3-[4-[2-butyl-1-[4-(3,4-dichlorophenoxy)phenyl]imidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 59699013) has the molecular formula C32H37Cl2N3O2 and a molecular weight of 566.57 g/mol. Its IUPAC name is 3-[4-[2-butyl-1-[4-(3,4-dichlorophenoxy)phenyl]imidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[2-butyl-1-[4-(3,4-dichlorophenoxy)phenyl]imidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 59699013 |
| Molecular Formula | C32H37Cl2N3O2 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 3-[4-[2-butyl-1-[4-(3,4-dichlorophenoxy)phenyl]imidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCCCc1nc(-c2ccc(OCCCN(CC)CC)cc2)cn1-c1ccc(Oc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C32H37Cl2N3O2/c1-4-7-9-32-35-31(24-10-14-26(15-11-24)38-21-8-20-36(5-2)6-3)23-37(32)25-12-16-27(17-13-25)39-28-18-19-29(33)30(34)22-28/h10-19,22-23H,4-9,20-21H2,1-3H3 |
| InChIKey | OJXPMPFLMIKJKU-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|