C30H34ClN3O3 — CID 123585783
1-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]imidazol-4-yl]phenoxy]-1-(dimethylamino)propan-2-ol (PubChem CID 123585783) has the molecular formula C30H34ClN3O3 and a molecular weight of 520.07 g/mol. Its IUPAC name is 1-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]imidazol-4-yl]phenoxy]-1-(dimethylamino)propan-2-ol.
| Compound Name | 1-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]imidazol-4-yl]phenoxy]-1-(dimethylamino)propan-2-ol |
|---|---|
| PubChem CID | 123585783 |
| Molecular Formula | C30H34ClN3O3 |
| Molecular Weight | 520.07 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 1-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]imidazol-4-yl]phenoxy]-1-(dimethylamino)propan-2-ol |
| SMILES | CCCCc1nc(-c2ccc(OC(C(C)O)N(C)C)cc2)cn1-c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H34ClN3O3/c1-5-6-7-29-32-28(22-8-14-27(15-9-22)37-30(21(2)35)33(3)4)20-34(29)24-12-18-26(19-13-24)36-25-16-10-23(31)11-17-25/h8-21,30,35H,5-7H2,1-4H3 |
| InChIKey | VEAMUHPZLZUNRA-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.07 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|