C32H38ClN3O3 — CID 59699123
3-[4-[4-[4-[2-(4-chlorophenyl)ethoxy]phenyl]-2-(methoxymethyl)imidazol-1-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 59699123) has the molecular formula C32H38ClN3O3 and a molecular weight of 548.13 g/mol. Its IUPAC name is 3-[4-[4-[4-[2-(4-chlorophenyl)ethoxy]phenyl]-2-(methoxymethyl)imidazol-1-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[4-[4-[2-(4-chlorophenyl)ethoxy]phenyl]-2-(methoxymethyl)imidazol-1-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 59699123 |
| Molecular Formula | C32H38ClN3O3 |
| Molecular Weight | 548.13 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | 3-[4-[4-[4-[2-(4-chlorophenyl)ethoxy]phenyl]-2-(methoxymethyl)imidazol-1-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc(-n2cc(-c3ccc(OCCc4ccc(Cl)cc4)cc3)nc2COC)cc1 |
| InChI | InChI=1S/C32H38ClN3O3/c1-4-35(5-2)20-6-21-38-30-17-13-28(14-18-30)36-23-31(34-32(36)24-37-3)26-9-15-29(16-10-26)39-22-19-25-7-11-27(33)12-8-25/h7-18,23H,4-6,19-22,24H2,1-3H3 |
| InChIKey | MRSSIFJLZXFGND-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.13 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|