C33H35F4N3O2 — CID 59698909
3-[4-[2-but-3-enyl-1-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]phenyl]imidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 59698909) has the molecular formula C33H35F4N3O2 and a molecular weight of 581.65 g/mol. Its IUPAC name is 3-[4-[2-but-3-enyl-1-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]phenyl]imidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[2-but-3-enyl-1-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]phenyl]imidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 59698909 |
| Molecular Formula | C33H35F4N3O2 |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | 3-[4-[2-but-3-enyl-1-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]phenyl]imidazol-4-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | C=CCCc1nc(-c2ccc(OCCCN(CC)CC)cc2)cn1-c1ccc(Oc2ccc(F)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C33H35F4N3O2/c1-4-7-9-32-38-31(24-10-14-26(15-11-24)41-21-8-20-39(5-2)6-3)23-40(32)25-12-16-27(17-13-25)42-28-18-19-30(34)29(22-28)33(35,36)37/h4,10-19,22-23H,1,5-9,20-21H2,2-3H3 |
| InChIKey | WLCAFUFAQSAZIN-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|