C32H38ClN3O2 — CID 59699189
3-[4-[2-butyl-4-[4-(4-chlorophenoxy)phenyl]imidazol-1-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 59699189) has the molecular formula C32H38ClN3O2 and a molecular weight of 532.13 g/mol. Its IUPAC name is 3-[4-[2-butyl-4-[4-(4-chlorophenoxy)phenyl]imidazol-1-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[2-butyl-4-[4-(4-chlorophenoxy)phenyl]imidazol-1-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 59699189 |
| Molecular Formula | C32H38ClN3O2 |
| Molecular Weight | 532.13 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 3-[4-[2-butyl-4-[4-(4-chlorophenoxy)phenyl]imidazol-1-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCCCc1nc(-c2ccc(Oc3ccc(Cl)cc3)cc2)cn1-c1ccc(OCCCN(CC)CC)cc1 |
| InChI | InChI=1S/C32H38ClN3O2/c1-4-7-9-32-34-31(25-10-16-29(17-11-25)38-30-18-12-26(33)13-19-30)24-36(32)27-14-20-28(21-15-27)37-23-8-22-35(5-2)6-3/h10-21,24H,4-9,22-23H2,1-3H3 |
| InChIKey | PWGADFKSBNBILW-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.13 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|