C28H30ClN3O4 — CID 123976816
1-[4-[1-[4-(4-chlorophenoxy)phenyl]-2-(ethoxymethyl)imidazol-4-yl]phenoxy]-1-(methylamino)propan-2-ol (PubChem CID 123976816) has the molecular formula C28H30ClN3O4 and a molecular weight of 508.02 g/mol. Its IUPAC name is 1-[4-[1-[4-(4-chlorophenoxy)phenyl]-2-(ethoxymethyl)imidazol-4-yl]phenoxy]-1-(methylamino)propan-2-ol.
| Compound Name | 1-[4-[1-[4-(4-chlorophenoxy)phenyl]-2-(ethoxymethyl)imidazol-4-yl]phenoxy]-1-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 123976816 |
| Molecular Formula | C28H30ClN3O4 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 1-[4-[1-[4-(4-chlorophenoxy)phenyl]-2-(ethoxymethyl)imidazol-4-yl]phenoxy]-1-(methylamino)propan-2-ol |
| SMILES | CCOCc1nc(-c2ccc(OC(NC)C(C)O)cc2)cn1-c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H30ClN3O4/c1-4-34-18-27-31-26(20-5-11-25(12-6-20)36-28(30-3)19(2)33)17-32(27)22-9-15-24(16-10-22)35-23-13-7-21(29)8-14-23/h5-17,19,28,30,33H,4,18H2,1-3H3 |
| InChIKey | HSMCDXCZBXWFAA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|