C33H36ClN3O3 — CID 86303919
6-[4-[2-(4-chlorophenyl)ethoxy]phenyl]-N-[4-[3-(diethylamino)propoxy]phenyl]pyridine-3-carboxamide (PubChem CID 86303919) has the molecular formula C33H36ClN3O3 and a molecular weight of 558.12 g/mol. Its IUPAC name is 6-[4-[2-(4-chlorophenyl)ethoxy]phenyl]-N-[4-[3-(diethylamino)propoxy]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-[4-[2-(4-chlorophenyl)ethoxy]phenyl]-N-[4-[3-(diethylamino)propoxy]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86303919 |
| Molecular Formula | C33H36ClN3O3 |
| Molecular Weight | 558.12 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 6-[4-[2-(4-chlorophenyl)ethoxy]phenyl]-N-[4-[3-(diethylamino)propoxy]phenyl]pyridine-3-carboxamide |
| SMILES | CCN(CC)CCCOc1ccc(NC(=O)c2ccc(-c3ccc(OCCc4ccc(Cl)cc4)cc3)nc2)cc1 |
| InChI | InChI=1S/C33H36ClN3O3/c1-3-37(4-2)21-5-22-39-31-17-13-29(14-18-31)36-33(38)27-10-19-32(35-24-27)26-8-15-30(16-9-26)40-23-20-25-6-11-28(34)12-7-25/h6-19,24H,3-5,20-23H2,1-2H3,(H,36,38) |
| InChIKey | CTDHCCOBLIRFBM-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.12 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|