C28H34N2O2 — CID 3324314
N-(4-pentoxyphenyl)-4-(5-pentyl-2-pyridinyl)benzamide (PubChem CID 3324314) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is N-(4-pentoxyphenyl)-4-(5-pentyl-2-pyridinyl)benzamide.
| Compound Name | N-(4-pentoxyphenyl)-4-(5-pentyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 3324314 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | N-(4-pentoxyphenyl)-4-(5-pentyl-2-pyridinyl)benzamide |
| SMILES | CCCCCOc1ccc(NC(=O)c2ccc(-c3ccc(CCCCC)cn3)cc2)cc1 |
| InChI | InChI=1S/C28H34N2O2/c1-3-5-7-9-22-10-19-27(29-21-22)23-11-13-24(14-12-23)28(31)30-25-15-17-26(18-16-25)32-20-8-6-4-2/h10-19,21H,3-9,20H2,1-2H3,(H,30,31) |
| InChIKey | VUGTULGKHBGLFJ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|