C57H60N6O3 — CID 140904471
N-[3,5-bis[[6-(4-pentylphenyl)pyridine-3-carbonyl]amino]phenyl]-6-(4-pentylphenyl)pyridine-3-carboxamide (PubChem CID 140904471) has the molecular formula C57H60N6O3 and a molecular weight of 877.15 g/mol. Its IUPAC name is N-[3,5-bis[[6-(4-pentylphenyl)pyridine-3-carbonyl]amino]phenyl]-6-(4-pentylphenyl)pyridine-3-carboxamide.
| Compound Name | N-[3,5-bis[[6-(4-pentylphenyl)pyridine-3-carbonyl]amino]phenyl]-6-(4-pentylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 140904471 |
| Molecular Formula | C57H60N6O3 |
| Molecular Weight | 877.15 g/mol |
| Exact Mass | 876.47 |
| IUPAC Name | N-[3,5-bis[[6-(4-pentylphenyl)pyridine-3-carbonyl]amino]phenyl]-6-(4-pentylphenyl)pyridine-3-carboxamide |
| SMILES | CCCCCc1ccc(-c2ccc(C(=O)Nc3cc(NC(=O)c4ccc(-c5ccc(CCCCC)cc5)nc4)cc(NC(=O)c4ccc(-c5ccc(CCCCC)cc5)nc4)c3)cn2)cc1 |
| InChI | InChI=1S/C57H60N6O3/c1-4-7-10-13-40-16-22-43(23-17-40)52-31-28-46(37-58-52)55(64)61-49-34-50(62-56(65)47-29-32-53(59-38-47)44-24-18-41(19-25-44)14-11-8-5-2)36-51(35-49)63-57(66)48-30-33-54(60-39-48)45-26-20-42(21-27-45)15-12-9-6-3/h16-39H,4-15H2,1-3H3,(H,61,64)(H,62,65)(H,63,66) |
| InChIKey | VJXAUUDKCTVDBZ-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.15 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|